C24H26N2O5 — CID 87226299
2-[2-(3-hydroxypropylamino)-5-pyridin-2-ylphenyl]-3,4,5-trimethoxybenzaldehyde (PubChem CID 87226299) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-[2-(3-hydroxypropylamino)-5-pyridin-2-ylphenyl]-3,4,5-trimethoxybenzaldehyde.
| Compound Name | 2-[2-(3-hydroxypropylamino)-5-pyridin-2-ylphenyl]-3,4,5-trimethoxybenzaldehyde |
|---|---|
| PubChem CID | 87226299 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-[2-(3-hydroxypropylamino)-5-pyridin-2-ylphenyl]-3,4,5-trimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)c(-c2cc(-c3ccccn3)ccc2NCCCO)c(OC)c1OC |
| InChI | InChI=1S/C24H26N2O5/c1-29-21-14-17(15-28)22(24(31-3)23(21)30-2)18-13-16(19-7-4-5-10-25-19)8-9-20(18)26-11-6-12-27/h4-5,7-10,13-15,26-27H,6,11-12H2,1-3H3 |
| InChIKey | GATQNSAMVATQSC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|