C23H22N2O5 — CID 25066423
N-[4-pyridin-2-yl-2-(3,4,5-trimethoxybenzoyl)phenyl]acetamide (PubChem CID 25066423) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is N-[4-pyridin-2-yl-2-(3,4,5-trimethoxybenzoyl)phenyl]acetamide.
| Compound Name | N-[4-pyridin-2-yl-2-(3,4,5-trimethoxybenzoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 25066423 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[4-pyridin-2-yl-2-(3,4,5-trimethoxybenzoyl)phenyl]acetamide |
| SMILES | COc1cc(C(=O)c2cc(-c3ccccn3)ccc2NC(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C23H22N2O5/c1-14(26)25-19-9-8-15(18-7-5-6-10-24-18)11-17(19)22(27)16-12-20(28-2)23(30-4)21(13-16)29-3/h5-13H,1-4H3,(H,25,26) |
| InChIKey | NLNWIMZRHJGNLY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |