C20H20N2O6S2 — CID 25067022
N-[4-(1,3-thiazol-2-yl)-2-(3,4,5-trimethoxybenzoyl)phenyl]methanesulfonamide (PubChem CID 25067022) has the molecular formula C20H20N2O6S2 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[4-(1,3-thiazol-2-yl)-2-(3,4,5-trimethoxybenzoyl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(1,3-thiazol-2-yl)-2-(3,4,5-trimethoxybenzoyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 25067022 |
| Molecular Formula | C20H20N2O6S2 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | N-[4-(1,3-thiazol-2-yl)-2-(3,4,5-trimethoxybenzoyl)phenyl]methanesulfonamide |
| SMILES | COc1cc(C(=O)c2cc(-c3nccs3)ccc2NS(C)(=O)=O)cc(OC)c1OC |
| InChI | InChI=1S/C20H20N2O6S2/c1-26-16-10-13(11-17(27-2)19(16)28-3)18(23)14-9-12(20-21-7-8-29-20)5-6-15(14)22-30(4,24)25/h5-11,22H,1-4H3 |
| InChIKey | VJEXEKXASROVAY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|