C22H21NO7S — CID 66987663
methoxymethyl 4-(1,3-thiazol-2-yl)-2-(3,4,5-trimethoxybenzoyl)benzoate (PubChem CID 66987663) has the molecular formula C22H21NO7S and a molecular weight of 443.48 g/mol. Its IUPAC name is methoxymethyl 4-(1,3-thiazol-2-yl)-2-(3,4,5-trimethoxybenzoyl)benzoate.
| Compound Name | methoxymethyl 4-(1,3-thiazol-2-yl)-2-(3,4,5-trimethoxybenzoyl)benzoate |
|---|---|
| PubChem CID | 66987663 |
| Molecular Formula | C22H21NO7S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | methoxymethyl 4-(1,3-thiazol-2-yl)-2-(3,4,5-trimethoxybenzoyl)benzoate |
| SMILES | COCOC(=O)c1ccc(-c2nccs2)cc1C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H21NO7S/c1-26-12-30-22(25)15-6-5-13(21-23-7-8-31-21)9-16(15)19(24)14-10-17(27-2)20(29-4)18(11-14)28-3/h5-11H,12H2,1-4H3 |
| InChIKey | FIKRRCYHILZSKJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|