C20H17NO6S — CID 66987615
4-(1,3-thiazol-2-yl)-2-(3,4,5-trimethoxybenzoyl)benzoic acid (PubChem CID 66987615) has the molecular formula C20H17NO6S and a molecular weight of 399.42 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-yl)-2-(3,4,5-trimethoxybenzoyl)benzoic acid.
| Compound Name | 4-(1,3-thiazol-2-yl)-2-(3,4,5-trimethoxybenzoyl)benzoic acid |
|---|---|
| PubChem CID | 66987615 |
| Molecular Formula | C20H17NO6S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 4-(1,3-thiazol-2-yl)-2-(3,4,5-trimethoxybenzoyl)benzoic acid |
| SMILES | COc1cc(C(=O)c2cc(-c3nccs3)ccc2C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C20H17NO6S/c1-25-15-9-12(10-16(26-2)18(15)27-3)17(22)14-8-11(19-21-6-7-28-19)4-5-13(14)20(23)24/h4-10H,1-3H3,(H,23,24) |
| InChIKey | NWZZHNCASHRQHX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |