C20H21NO7 — CID 87613103
formaldehyde;N-[4-formyl-2-(3,4,5-trimethoxybenzoyl)phenyl]acetamide (PubChem CID 87613103) has the molecular formula C20H21NO7 and a molecular weight of 387.39 g/mol. Its IUPAC name is formaldehyde;N-[4-formyl-2-(3,4,5-trimethoxybenzoyl)phenyl]acetamide.
| Compound Name | formaldehyde;N-[4-formyl-2-(3,4,5-trimethoxybenzoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 87613103 |
| Molecular Formula | C20H21NO7 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | formaldehyde;N-[4-formyl-2-(3,4,5-trimethoxybenzoyl)phenyl]acetamide |
| SMILES | C=O.COc1cc(C(=O)c2cc(C=O)ccc2NC(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C19H19NO6.CH2O/c1-11(22)20-15-6-5-12(10-21)7-14(15)18(23)13-8-16(24-2)19(26-4)17(9-13)25-3;1-2/h5-10H,1-4H3,(H,20,22);1H2 |
| InChIKey | ZRBPMCQEYYTRMU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|