C18H34O4 — CID 87229154
5-(3,3-dideuteriobutoxy)-9-hydroxy-5-methylnon-8-en-2-one;4,4,4-trideuteriobutan-2-one (PubChem CID 87229154) has the molecular formula C18H34O4 and a molecular weight of 319.50 g/mol. Its IUPAC name is 5-(3,3-dideuteriobutoxy)-9-hydroxy-5-methylnon-8-en-2-one;4,4,4-trideuteriobutan-2-one.
| Compound Name | 5-(3,3-dideuteriobutoxy)-9-hydroxy-5-methylnon-8-en-2-one;4,4,4-trideuteriobutan-2-one |
|---|---|
| PubChem CID | 87229154 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.28 |
| IUPAC Name | 5-(3,3-dideuteriobutoxy)-9-hydroxy-5-methylnon-8-en-2-one;4,4,4-trideuteriobutan-2-one |
| SMILES | [2H]C([2H])(C)CCOC(C)(CCC=CO)CCC(C)=O.[2H]C([2H])([2H])CC(C)=O |
| InChI | InChI=1S/C14H26O3.C4H8O/c1-4-5-12-17-14(3,9-6-7-11-15)10-8-13(2)16;1-3-4(2)5/h7,11,15H,4-6,8-10,12H2,1-3H3;3H2,1-2H3/i4D2;1D3 |
| InChIKey | BRFJLKBKPJKSNO-HCVGVLHVSA-N |
| XLogP | 4.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|