C34H31Cl2N5 — CID 87232426
[1-[4-[6-(2-benzyl-1H-pyrazol-2-ium-4-yl)-3-phenyl-1,7-naphthyridin-2-yl]phenyl]cyclobutyl]azanium dichloride (PubChem CID 87232426) has the molecular formula C34H31Cl2N5 and a molecular weight of 580.56 g/mol. Its IUPAC name is [1-[4-[6-(2-benzyl-1H-pyrazol-2-ium-4-yl)-3-phenyl-1,7-naphthyridin-2-yl]phenyl]cyclobutyl]azanium dichloride.
| Compound Name | [1-[4-[6-(2-benzyl-1H-pyrazol-2-ium-4-yl)-3-phenyl-1,7-naphthyridin-2-yl]phenyl]cyclobutyl]azanium dichloride |
|---|---|
| PubChem CID | 87232426 |
| Molecular Formula | C34H31Cl2N5 |
| Molecular Weight | 580.56 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | [1-[4-[6-(2-benzyl-1H-pyrazol-2-ium-4-yl)-3-phenyl-1,7-naphthyridin-2-yl]phenyl]cyclobutyl]azanium dichloride |
| SMILES | [Cl-].[Cl-].[NH3+]C1(c2ccc(-c3nc4cnc(-c5c[nH][n+](Cc6ccccc6)c5)cc4cc3-c3ccccc3)cc2)CCC1 |
| InChI | InChI=1S/C34H29N5.2ClH/c35-34(16-7-17-34)29-14-12-26(13-15-29)33-30(25-10-5-2-6-11-25)18-27-19-31(36-21-32(27)38-33)28-20-37-39(23-28)22-24-8-3-1-4-9-24;;/h1-6,8-15,18-21,23H,7,16-17,22,35H2;2*1H |
| InChIKey | MWYVJJGJXDVLMA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 73.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.56 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|