C7H14Br2O2 — CID 87234717
1,2-bis(1-bromoethoxy)propane (PubChem CID 87234717) has the molecular formula C7H14Br2O2 and a molecular weight of 290.00 g/mol. Its IUPAC name is 1,2-bis(1-bromoethoxy)propane.
| Compound Name | 1,2-bis(1-bromoethoxy)propane |
|---|---|
| PubChem CID | 87234717 |
| Molecular Formula | C7H14Br2O2 |
| Molecular Weight | 290.00 g/mol |
| Exact Mass | 287.94 |
| IUPAC Name | 1,2-bis(1-bromoethoxy)propane |
| SMILES | CC(Br)OCC(C)OC(C)Br |
| InChI | InChI=1S/C7H14Br2O2/c1-5(11-7(3)9)4-10-6(2)8/h5-7H,4H2,1-3H3 |
| InChIKey | ABVGBNKAFQWKJK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.00 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|