C21H24N2O6 — CID 87235219
9H-fluoren-9-ylmethyl 2-[diamino(carboxyperoxy)methyl]pentanoate (PubChem CID 87235219) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 2-[diamino(carboxyperoxy)methyl]pentanoate.
| Compound Name | 9H-fluoren-9-ylmethyl 2-[diamino(carboxyperoxy)methyl]pentanoate |
|---|---|
| PubChem CID | 87235219 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 2-[diamino(carboxyperoxy)methyl]pentanoate |
| SMILES | CCCC(C(=O)OCC1c2ccccc2-c2ccccc21)C(N)(N)OOC(=O)O |
| InChI | InChI=1S/C21H24N2O6/c1-2-7-18(21(22,23)29-28-20(25)26)19(24)27-12-17-15-10-5-3-8-13(15)14-9-4-6-11-16(14)17/h3-6,8-11,17-18H,2,7,12,22-23H2,1H3,(H,25,26) |
| InChIKey | MQLQYHOWSJGUBG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 134.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|