About CID 87238691
CID 87238691 (PubChem CID 87238691) has the molecular formula C20H41AlO4
and a molecular weight of 372.53 g/mol.
Molecular Properties
| Compound Name | CID 87238691 |
| PubChem CID | 87238691 |
| Molecular Formula | C20H41AlO4 |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | — |
| SMILES | CC(C)C[Al].CCCCC(CC)C(=O)O.CCCCC(CC)C(=O)O |
| InChI | InChI=1S/2C8H16O2.C4H9.Al/c2*1-3-5-6-7(4-2)8(9)10;1-4(2)3;/h2*7H,3-6H2,1-2H3,(H,9,10);4H,1H2,2-3H3; |
| InChIKey | HCNOHIOUQRNABO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 87238691 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87238691?
The IUPAC name of CID 87238691 (CID 87238691) is not available.
What is the SMILES notation for CID 87238691?
The canonical SMILES for CID 87238691 is CC(C)C[Al].CCCCC(CC)C(=O)O.CCCCC(CC)C(=O)O.
What is the InChIKey of CID 87238691?
The InChIKey is HCNOHIOUQRNABO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H16O2.C4H9.Al/c2*1-3-5-6-7(4-2)8(9)10;1-4(2)3;/h2*7H,3-6H2,1-2H3,(H,9,10);4H,1H2,2-3H3;.
What are the key properties of CID 87238691?
CID 87238691 has a molecular weight of 372.53 g/mol, XLogP of 5.80, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87238691 is sourced from PubChem (CID 87238691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).