About neodymium;(4-nonylphenoxy)-(4-nonylphenyl)-oxophosphanium
neodymium;(4-nonylphenoxy)-(4-nonylphenyl)-oxophosphanium (PubChem CID 87238694) has the molecular formula C30H46NdO2P+
and a molecular weight of 613.91 g/mol. Its IUPAC name is neodymium;(4-nonylphenoxy)-(4-nonylphenyl)-oxophosphanium.
Molecular Properties
| Compound Name | neodymium;(4-nonylphenoxy)-(4-nonylphenyl)-oxophosphanium |
| PubChem CID | 87238694 |
| Molecular Formula | C30H46NdO2P+ |
| Molecular Weight | 613.91 g/mol |
| Exact Mass | 611.23 |
| IUPAC Name | neodymium;(4-nonylphenoxy)-(4-nonylphenyl)-oxophosphanium |
| SMILES | CCCCCCCCCc1ccc(O[P+](=O)c2ccc(CCCCCCCCC)cc2)cc1.[Nd] |
| InChI | InChI=1S/C30H46O2P.Nd/c1-3-5-7-9-11-13-15-17-27-19-23-29(24-20-27)32-33(31)30-25-21-28(22-26-30)18-16-14-12-10-8-6-4-2;/h19-26H,3-18H2,1-2H3;/q+1; |
| InChIKey | DJLBPSAWOUKYHT-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 613.91 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze neodymium;(4-nonylphenoxy)-(4-nonylphenyl)-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of neodymium;(4-nonylphenoxy)-(4-nonylphenyl)-oxophosphanium?
The IUPAC name of neodymium;(4-nonylphenoxy)-(4-nonylphenyl)-oxophosphanium (CID 87238694) is neodymium;(4-nonylphenoxy)-(4-nonylphenyl)-oxophosphanium.
What is the SMILES notation for neodymium;(4-nonylphenoxy)-(4-nonylphenyl)-oxophosphanium?
The canonical SMILES for neodymium;(4-nonylphenoxy)-(4-nonylphenyl)-oxophosphanium is CCCCCCCCCc1ccc(O[P+](=O)c2ccc(CCCCCCCCC)cc2)cc1.[Nd].
What is the InChIKey of neodymium;(4-nonylphenoxy)-(4-nonylphenyl)-oxophosphanium?
The InChIKey is DJLBPSAWOUKYHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H46O2P.Nd/c1-3-5-7-9-11-13-15-17-27-19-23-29(24-20-27)32-33(31)30-25-21-28(22-26-30)18-16-14-12-10-8-6-4-2;/h19-26H,3-18H2,1-2H3;/q+1;.
What are the key properties of neodymium;(4-nonylphenoxy)-(4-nonylphenyl)-oxophosphanium?
neodymium;(4-nonylphenoxy)-(4-nonylphenyl)-oxophosphanium has a molecular weight of 613.91 g/mol, XLogP of 9.72, 19 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for neodymium;(4-nonylphenoxy)-(4-nonylphenyl)-oxophosphanium is sourced from PubChem (CID 87238694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).