C17H24N2O4 — CID 87239871
(2R)-2-[2-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]ethylamino]-4-methylpentanoic acid (PubChem CID 87239871) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2R)-2-[2-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]ethylamino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[2-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]ethylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 87239871 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (2R)-2-[2-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]ethylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NCCc1ccc(/C=C/C(=O)NO)cc1)C(=O)O |
| InChI | InChI=1S/C17H24N2O4/c1-12(2)11-15(17(21)22)18-10-9-14-5-3-13(4-6-14)7-8-16(20)19-23/h3-8,12,15,18,23H,9-11H2,1-2H3,(H,19,20)(H,21,22)/b8-7+/t15-/m1/s1 |
| InChIKey | LTCUYIYQVZRTSG-MVGZEHJDSA-N |
| XLogP | 1.84 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|