C26H30F5NO4S — CID 87241655
2,3,4,5,6-pentafluoro-N-[[1-[[4-[2-(oxan-2-yloxy)ethyl]phenyl]methyl]cyclopentyl]methyl]benzenesulfonamide (PubChem CID 87241655) has the molecular formula C26H30F5NO4S and a molecular weight of 547.59 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[1-[[4-[2-(oxan-2-yloxy)ethyl]phenyl]methyl]cyclopentyl]methyl]benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[1-[[4-[2-(oxan-2-yloxy)ethyl]phenyl]methyl]cyclopentyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 87241655 |
| Molecular Formula | C26H30F5NO4S |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[1-[[4-[2-(oxan-2-yloxy)ethyl]phenyl]methyl]cyclopentyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1(Cc2ccc(CCOC3CCCCO3)cc2)CCCC1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C26H30F5NO4S/c27-20-21(28)23(30)25(24(31)22(20)29)37(33,34)32-16-26(11-2-3-12-26)15-18-8-6-17(7-9-18)10-14-36-19-5-1-4-13-35-19/h6-9,19,32H,1-5,10-16H2 |
| InChIKey | RRRMJFMVEBZGKT-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|