About 6-diazocyclohexa-2,4-diene-1,2-diamine
6-diazocyclohexa-2,4-diene-1,2-diamine (PubChem CID 87243053) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is 6-diazocyclohexa-2,4-diene-1,2-diamine.
Molecular Properties
| Compound Name | 6-diazocyclohexa-2,4-diene-1,2-diamine |
| PubChem CID | 87243053 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 6-diazocyclohexa-2,4-diene-1,2-diamine |
| SMILES | [N-]=[N+]=C1C=CC=C(N)C1N |
| InChI | InChI=1S/C6H8N4/c7-4-2-1-3-5(10-9)6(4)8/h1-3,6H,7-8H2 |
| InChIKey | VQLZOGWNQQEFHR-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-diazocyclohexa-2,4-diene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-diazocyclohexa-2,4-diene-1,2-diamine?
The IUPAC name of 6-diazocyclohexa-2,4-diene-1,2-diamine (CID 87243053) is 6-diazocyclohexa-2,4-diene-1,2-diamine.
What is the SMILES notation for 6-diazocyclohexa-2,4-diene-1,2-diamine?
The canonical SMILES for 6-diazocyclohexa-2,4-diene-1,2-diamine is [N-]=[N+]=C1C=CC=C(N)C1N.
What is the InChIKey of 6-diazocyclohexa-2,4-diene-1,2-diamine?
The InChIKey is VQLZOGWNQQEFHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4/c7-4-2-1-3-5(10-9)6(4)8/h1-3,6H,7-8H2.
What are the key properties of 6-diazocyclohexa-2,4-diene-1,2-diamine?
6-diazocyclohexa-2,4-diene-1,2-diamine has a molecular weight of 136.16 g/mol, XLogP of -0.60, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-diazocyclohexa-2,4-diene-1,2-diamine is sourced from PubChem (CID 87243053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).