C6H8N4 — CID 89251664
6-diazocyclohexa-1,3-diene-1,2-diamine (PubChem CID 89251664) has the molecular formula C6H8N4 and a molecular weight of 136.16 g/mol. Its IUPAC name is 6-diazocyclohexa-1,3-diene-1,2-diamine.
| Compound Name | 6-diazocyclohexa-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 89251664 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 6-diazocyclohexa-1,3-diene-1,2-diamine |
| SMILES | [N-]=[N+]=C1CC=CC(N)=C1N |
| InChI | InChI=1S/C6H8N4/c7-4-2-1-3-5(10-9)6(4)8/h1-2H,3,7-8H2 |
| InChIKey | CONYNKKCTGYCTP-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|