C12H15N3 — CID 143547687
cyclohexa-1,5-dien-1-amine;cyclohexa-3,5-diene-1,2-diimine (PubChem CID 143547687) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-amine;cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | cyclohexa-1,5-dien-1-amine;cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 143547687 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | cyclohexa-1,5-dien-1-amine;cyclohexa-3,5-diene-1,2-diimine |
| SMILES | NC1=CCCC=C1.[H]/N=C1\C=CC=C\C1=N/[H] |
| InChI | InChI=1S/C6H6N2.C6H9N/c7-5-3-1-2-4-6(5)8;7-6-4-2-1-3-5-6/h1-4,7-8H;2,4-5H,1,3,7H2/b7-5+,8-6+; |
| InChIKey | GMLQNQDQNSRDDI-PUFOULASSA-N |
| XLogP | 2.33 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|