C25H29BrN2O5 — CID 87243254
benzyl-[(2R)-1-[[3-bromo-1-(2,4-dimethoxyphenyl)but-3-enyl]amino]-1-oxopent-4-en-2-yl]carbamic acid (PubChem CID 87243254) has the molecular formula C25H29BrN2O5 and a molecular weight of 517.42 g/mol. Its IUPAC name is benzyl-[(2R)-1-[[3-bromo-1-(2,4-dimethoxyphenyl)but-3-enyl]amino]-1-oxopent-4-en-2-yl]carbamic acid.
| Compound Name | benzyl-[(2R)-1-[[3-bromo-1-(2,4-dimethoxyphenyl)but-3-enyl]amino]-1-oxopent-4-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87243254 |
| Molecular Formula | C25H29BrN2O5 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | benzyl-[(2R)-1-[[3-bromo-1-(2,4-dimethoxyphenyl)but-3-enyl]amino]-1-oxopent-4-en-2-yl]carbamic acid |
| SMILES | C=CC[C@H](C(=O)NC(CC(=C)Br)c1ccc(OC)cc1OC)N(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H29BrN2O5/c1-5-9-22(28(25(30)31)16-18-10-7-6-8-11-18)24(29)27-21(14-17(2)26)20-13-12-19(32-3)15-23(20)33-4/h5-8,10-13,15,21-22H,1-2,9,14,16H2,3-4H3,(H,27,29)(H,30,31)/t21?,22-/m1/s1 |
| InChIKey | YFEXJOMPNVUYKN-FOIFJWKZSA-N |
| XLogP | 5.28 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|