C11H21NO5Si — CID 87246800
6-(1-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane (PubChem CID 87246800) has the molecular formula C11H21NO5Si and a molecular weight of 275.38 g/mol. Its IUPAC name is 6-(1-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane.
| Compound Name | 6-(1-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane |
|---|---|
| PubChem CID | 87246800 |
| Molecular Formula | C11H21NO5Si |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 6-(1-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane |
| SMILES | CCC(N=C=O)C1(OC)CCC[Si](OC)(OC)O1 |
| InChI | InChI=1S/C11H21NO5Si/c1-5-10(12-9-13)11(14-2)7-6-8-18(15-3,16-4)17-11/h10H,5-8H2,1-4H3 |
| InChIKey | SDJBCGPLZQKUOL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|