C53H66N6O3 — CID 87248166
(9-hexylcarbazol-3-yl)methyl 6-[4-[4-cyano-5-(dicyanomethylidene)-1-hexyl-2-oxopyrrol-3-yl]-N-(2-ethylhexyl)anilino]hexanoate (PubChem CID 87248166) has the molecular formula C53H66N6O3 and a molecular weight of 835.15 g/mol. Its IUPAC name is (9-hexylcarbazol-3-yl)methyl 6-[4-[4-cyano-5-(dicyanomethylidene)-1-hexyl-2-oxopyrrol-3-yl]-N-(2-ethylhexyl)anilino]hexanoate.
| Compound Name | (9-hexylcarbazol-3-yl)methyl 6-[4-[4-cyano-5-(dicyanomethylidene)-1-hexyl-2-oxopyrrol-3-yl]-N-(2-ethylhexyl)anilino]hexanoate |
|---|---|
| PubChem CID | 87248166 |
| Molecular Formula | C53H66N6O3 |
| Molecular Weight | 835.15 g/mol |
| Exact Mass | 834.52 |
| IUPAC Name | (9-hexylcarbazol-3-yl)methyl 6-[4-[4-cyano-5-(dicyanomethylidene)-1-hexyl-2-oxopyrrol-3-yl]-N-(2-ethylhexyl)anilino]hexanoate |
| SMILES | CCCCCCN1C(=O)C(c2ccc(N(CCCCCC(=O)OCc3ccc4c(c3)c3ccccc3n4CCCCCC)CC(CC)CCCC)cc2)=C(C#N)C1=C(C#N)C#N |
| InChI | InChI=1S/C53H66N6O3/c1-5-9-12-19-32-58-48-23-17-16-22-45(48)46-34-41(25-30-49(46)58)39-62-50(60)24-15-14-18-31-57(38-40(8-4)21-11-7-3)44-28-26-42(27-29-44)51-47(37-56)52(43(35-54)36-55)59(53(51)61)33-20-13-10-6-2/h16-17,22-23,25-30,34,40H,5-15,18-21,24,31-33,38-39H2,1-4H3 |
| InChIKey | BEWKBYYLFNHDNZ-UHFFFAOYSA-N |
| XLogP | 12.70 |
| TPSA | 126.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.15 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|