C21H29NO5 — CID 87251936
2-[(8R,9S,10R,13S,14S)-2-hydroxy-3-hydroxyimino-10,13-dimethyl-17-oxo-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-yl]acetic acid (PubChem CID 87251936) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-[(8R,9S,10R,13S,14S)-2-hydroxy-3-hydroxyimino-10,13-dimethyl-17-oxo-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-yl]acetic acid.
| Compound Name | 2-[(8R,9S,10R,13S,14S)-2-hydroxy-3-hydroxyimino-10,13-dimethyl-17-oxo-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-yl]acetic acid |
|---|---|
| PubChem CID | 87251936 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 2-[(8R,9S,10R,13S,14S)-2-hydroxy-3-hydroxyimino-10,13-dimethyl-17-oxo-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-yl]acetic acid |
| SMILES | C[C@]12CC(O)C(=NO)CC1=CC(CC(=O)O)[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H29NO5/c1-20-6-5-14-19(13(20)3-4-17(20)24)11(8-18(25)26)7-12-9-15(22-27)16(23)10-21(12,14)2/h7,11,13-14,16,19,23,27H,3-6,8-10H2,1-2H3,(H,25,26)/t11?,13-,14-,16?,19-,20-,21-/m0/s1 |
| InChIKey | WYWMTFZLLVDVGJ-KNELGYAMSA-N |
| XLogP | 3.02 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|