C8H9ClLiN2O2 — CID 87258887
CID 87258887 (PubChem CID 87258887) has the molecular formula C8H9ClLiN2O2 and a molecular weight of 207.57 g/mol.
| Compound Name | CID 87258887 |
|---|---|
| PubChem CID | 87258887 |
| Molecular Formula | C8H9ClLiN2O2 |
| Molecular Weight | 207.57 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | — |
| SMILES | CC(C)(C(=O)O)c1ccc(Cl)nn1.[Li] |
| InChI | InChI=1S/C8H9ClN2O2.Li/c1-8(2,7(12)13)5-3-4-6(9)11-10-5;/h3-4H,1-2H3,(H,12,13); |
| InChIKey | DCODDJZZWLLKQO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.57 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |