C17H24N6O4 — CID 87264211
N-hydroxy-N-[(2S)-2-[[(7-methoxy-1,2,4-benzotriazin-3-yl)amino]carbamoyl]-5-methylhexyl]formamide (PubChem CID 87264211) has the molecular formula C17H24N6O4 and a molecular weight of 376.42 g/mol. Its IUPAC name is N-hydroxy-N-[(2S)-2-[[(7-methoxy-1,2,4-benzotriazin-3-yl)amino]carbamoyl]-5-methylhexyl]formamide.
| Compound Name | N-hydroxy-N-[(2S)-2-[[(7-methoxy-1,2,4-benzotriazin-3-yl)amino]carbamoyl]-5-methylhexyl]formamide |
|---|---|
| PubChem CID | 87264211 |
| Molecular Formula | C17H24N6O4 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-hydroxy-N-[(2S)-2-[[(7-methoxy-1,2,4-benzotriazin-3-yl)amino]carbamoyl]-5-methylhexyl]formamide |
| SMILES | COc1ccc2nc(NNC(=O)[C@@H](CCC(C)C)CN(O)C=O)nnc2c1 |
| InChI | InChI=1S/C17H24N6O4/c1-11(2)4-5-12(9-23(26)10-24)16(25)20-22-17-18-14-7-6-13(27-3)8-15(14)19-21-17/h6-8,10-12,26H,4-5,9H2,1-3H3,(H,20,25)(H,18,21,22)/t12-/m0/s1 |
| InChIKey | WBFYKSGRYVTDKY-LBPRGKRZSA-N |
| XLogP | 1.38 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|