C19H26N6O3 — CID 87264525
N-[4-cyclopentyl-2-[[(7-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]butyl]-N-hydroxyformamide (PubChem CID 87264525) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-[4-cyclopentyl-2-[[(7-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]butyl]-N-hydroxyformamide.
| Compound Name | N-[4-cyclopentyl-2-[[(7-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]butyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87264525 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-[4-cyclopentyl-2-[[(7-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]butyl]-N-hydroxyformamide |
| SMILES | Cc1ccc2nc(NNC(=O)C(CCC3CCCC3)CN(O)C=O)nnc2c1 |
| InChI | InChI=1S/C19H26N6O3/c1-13-6-9-16-17(10-13)21-23-19(20-16)24-22-18(27)15(11-25(28)12-26)8-7-14-4-2-3-5-14/h6,9-10,12,14-15,28H,2-5,7-8,11H2,1H3,(H,22,27)(H,20,23,24) |
| InChIKey | GVLKABCMYHPUIB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|