C17H34N2O3 — CID 87267021
(3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoic acid;(3S)-oct-1-en-3-amine (PubChem CID 87267021) has the molecular formula C17H34N2O3 and a molecular weight of 314.47 g/mol. Its IUPAC name is (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoic acid;(3S)-oct-1-en-3-amine.
| Compound Name | (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoic acid;(3S)-oct-1-en-3-amine |
|---|---|
| PubChem CID | 87267021 |
| Molecular Formula | C17H34N2O3 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoic acid;(3S)-oct-1-en-3-amine |
| SMILES | C=C[C@@H](N)CCCCC.CC(C)C[C@H](CC(N)=O)CC(=O)O |
| InChI | InChI=1S/C9H17NO3.C8H17N/c1-6(2)3-7(4-8(10)11)5-9(12)13;1-3-5-6-7-8(9)4-2/h6-7H,3-5H2,1-2H3,(H2,10,11)(H,12,13);4,8H,2-3,5-7,9H2,1H3/t7-;8-/m11/s1 |
| InChIKey | WRHCVSLMJFQHKV-GAIJEYQGSA-N |
| XLogP | 3.08 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|