C17H31NO3 — CID 87615441
(3R)-5-methyl-3-[2-[[(3R)-oct-1-en-3-yl]amino]-2-oxoethyl]hexanoic acid (PubChem CID 87615441) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is (3R)-5-methyl-3-[2-[[(3R)-oct-1-en-3-yl]amino]-2-oxoethyl]hexanoic acid.
| Compound Name | (3R)-5-methyl-3-[2-[[(3R)-oct-1-en-3-yl]amino]-2-oxoethyl]hexanoic acid |
|---|---|
| PubChem CID | 87615441 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | (3R)-5-methyl-3-[2-[[(3R)-oct-1-en-3-yl]amino]-2-oxoethyl]hexanoic acid |
| SMILES | C=C[C@@H](CCCCC)NC(=O)C[C@H](CC(=O)O)CC(C)C |
| InChI | InChI=1S/C17H31NO3/c1-5-7-8-9-15(6-2)18-16(19)11-14(10-13(3)4)12-17(20)21/h6,13-15H,2,5,7-12H2,1,3-4H3,(H,18,19)(H,20,21)/t14-,15+/m1/s1 |
| InChIKey | CTPYRAHVCGLPSN-CABCVRRESA-N |
| XLogP | 3.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|