methyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate

C12H22F3NO2 — CID 87269651

IUPACmethyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate
SMILESCCC(NCCC(C)(C)C)(C(=O)OC)C(F)(F)F
InChIInChI=1S/C12H22F3NO2/c1-6-11(9(17)18-5,12(13,14)15)16-8-7-10(2,3)4/h16H,6-8H2,1-5H3
InChIKeyPPZKYZDJPPPQDS-UHFFFAOYSA-N
MW269.31 g/mol
LogP2.90
Rot. Bonds5

About methyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate

methyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate (PubChem CID 87269651) has the molecular formula C12H22F3NO2 and a molecular weight of 269.31 g/mol. Its IUPAC name is methyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate.

Molecular Properties

Compound Namemethyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate
PubChem CID87269651
Molecular FormulaC12H22F3NO2
Molecular Weight269.31 g/mol
Exact Mass269.16
IUPAC Namemethyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate
SMILESCCC(NCCC(C)(C)C)(C(=O)OC)C(F)(F)F
InChIInChI=1S/C12H22F3NO2/c1-6-11(9(17)18-5,12(13,14)15)16-8-7-10(2,3)4/h16H,6-8H2,1-5H3
InChIKeyPPZKYZDJPPPQDS-UHFFFAOYSA-N
XLogP2.90
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.31
LogP ≤ 52.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate?
The IUPAC name of methyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate (CID 87269651) is methyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate.
What is the SMILES notation for methyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate?
The canonical SMILES for methyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate is CCC(NCCC(C)(C)C)(C(=O)OC)C(F)(F)F.
What is the InChIKey of methyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate?
The InChIKey is PPZKYZDJPPPQDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3NO2/c1-6-11(9(17)18-5,12(13,14)15)16-8-7-10(2,3)4/h16H,6-8H2,1-5H3.
What are the key properties of methyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate?
methyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate has a molecular weight of 269.31 g/mol, XLogP of 2.90, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,3-dimethylbutylamino)-2-(trifluoromethyl)butanoate is sourced from PubChem (CID 87269651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).