C23H46NO2P — CID 87269904
(Z)-1-[1-hydroxy-2-(trimethylazaniumyl)ethyl]phosphanylideneoctadec-9-en-1-olate (PubChem CID 87269904) has the molecular formula C23H46NO2P and a molecular weight of 399.60 g/mol. Its IUPAC name is (Z)-1-[1-hydroxy-2-(trimethylazaniumyl)ethyl]phosphanylideneoctadec-9-en-1-olate.
| Compound Name | (Z)-1-[1-hydroxy-2-(trimethylazaniumyl)ethyl]phosphanylideneoctadec-9-en-1-olate |
|---|---|
| PubChem CID | 87269904 |
| Molecular Formula | C23H46NO2P |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.33 |
| IUPAC Name | (Z)-1-[1-hydroxy-2-(trimethylazaniumyl)ethyl]phosphanylideneoctadec-9-en-1-olate |
| SMILES | CCCCCCCC/C=C\CCCCCCC/C([O-])=P/C(O)C[N+](C)(C)C |
| InChI | InChI=1S/C23H46NO2P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(25)27-23(26)21-24(2,3)4/h12-13,23,26H,5-11,14-21H2,1-4H3/b13-12- |
| InChIKey | YUHGBCXHTGUUIW-SEYXRHQNSA-N |
| XLogP | 5.48 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|