C32H37N9 — CID 87270479
3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1,4,6,10,12,14-hexaen-5-yl)-1,2,4-triazole-3,5-diamine (PubChem CID 87270479) has the molecular formula C32H37N9 and a molecular weight of 547.71 g/mol. Its IUPAC name is 3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1,4,6,10,12,14-hexaen-5-yl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1,4,6,10,12,14-hexaen-5-yl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 87270479 |
| Molecular Formula | C32H37N9 |
| Molecular Weight | 547.71 g/mol |
| Exact Mass | 547.32 |
| IUPAC Name | 3-N-[4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]phenyl]-1-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1,4,6,10,12,14-hexaen-5-yl)-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(Nc2ccc(N3CCN(C4CC5CCC4C5)CC3)cc2)nn1C1=NNC2=c3ccccc3=CCCC2=C1 |
| InChI | InChI=1S/C32H37N9/c33-31-35-32(38-41(31)29-20-24-6-3-5-22-4-1-2-7-27(22)30(24)37-36-29)34-25-10-12-26(13-11-25)39-14-16-40(17-15-39)28-19-21-8-9-23(28)18-21/h1-2,4-5,7,10-13,20-21,23,28,37H,3,6,8-9,14-19H2,(H3,33,34,35,38) |
| InChIKey | NVEKJOSDNHKKFG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.71 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|