C8H12N6O5 — CID 87270878
2-(2-methyl-5-nitroanilino)guanidine;nitric acid (PubChem CID 87270878) has the molecular formula C8H12N6O5 and a molecular weight of 272.22 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroanilino)guanidine;nitric acid.
| Compound Name | 2-(2-methyl-5-nitroanilino)guanidine;nitric acid |
|---|---|
| PubChem CID | 87270878 |
| Molecular Formula | C8H12N6O5 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-(2-methyl-5-nitroanilino)guanidine;nitric acid |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NN=C(N)N.O=[N+]([O-])O |
| InChI | InChI=1S/C8H11N5O2.HNO3/c1-5-2-3-6(13(14)15)4-7(5)11-12-8(9)10;2-1(3)4/h2-4,11H,1H3,(H4,9,10,12);(H,2,3,4) |
| InChIKey | MBUBGWQKYMCJRA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 182.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|