C13H13BrF2N2O3S2 — CID 87273286
1-bromo-N-[[3,5-difluoro-4-(methanesulfonamido)phenyl]methyl]thiophene-1-carboxamide (PubChem CID 87273286) has the molecular formula C13H13BrF2N2O3S2 and a molecular weight of 427.29 g/mol. Its IUPAC name is 1-bromo-N-[[3,5-difluoro-4-(methanesulfonamido)phenyl]methyl]thiophene-1-carboxamide.
| Compound Name | 1-bromo-N-[[3,5-difluoro-4-(methanesulfonamido)phenyl]methyl]thiophene-1-carboxamide |
|---|---|
| PubChem CID | 87273286 |
| Molecular Formula | C13H13BrF2N2O3S2 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 425.95 |
| IUPAC Name | 1-bromo-N-[[3,5-difluoro-4-(methanesulfonamido)phenyl]methyl]thiophene-1-carboxamide |
| SMILES | CS(=O)(=O)Nc1c(F)cc(CNC(=O)S2(Br)C=CC=C2)cc1F |
| InChI | InChI=1S/C13H13BrF2N2O3S2/c1-22(20,21)18-12-10(15)6-9(7-11(12)16)8-17-13(19)23(14)4-2-3-5-23/h2-7,18H,8H2,1H3,(H,17,19) |
| InChIKey | KWOURSPSGBETHT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|