C22H18Cl2F6N4O2 — CID 87278627
1-[(Z)-1-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]ethylideneamino]-3-(1,1,2-trifluoroethyl)urea (PubChem CID 87278627) has the molecular formula C22H18Cl2F6N4O2 and a molecular weight of 555.31 g/mol. Its IUPAC name is 1-[(Z)-1-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]ethylideneamino]-3-(1,1,2-trifluoroethyl)urea.
| Compound Name | 1-[(Z)-1-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]ethylideneamino]-3-(1,1,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 87278627 |
| Molecular Formula | C22H18Cl2F6N4O2 |
| Molecular Weight | 555.31 g/mol |
| Exact Mass | 554.07 |
| IUPAC Name | 1-[(Z)-1-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]ethylideneamino]-3-(1,1,2-trifluoroethyl)urea |
| SMILES | C/C(=N/NC(=O)NC(F)(F)CF)c1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1C |
| InChI | InChI=1S/C22H18Cl2F6N4O2/c1-11-5-13(3-4-17(11)12(2)32-33-19(35)31-21(26,27)10-25)18-9-20(36-34-18,22(28,29)30)14-6-15(23)8-16(24)7-14/h3-8H,9-10H2,1-2H3,(H2,31,33,35)/b32-12- |
| InChIKey | OZUVDVRPEGCNFL-ULTCEKQJSA-N |
| XLogP | 6.47 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.31 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|