C31H41N6O7S+ — CID 87279217
[3-[6-[[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenyl]carbamoyl]-3-pyridinyl]-1,2,2,6,6-pentamethyl-4-oxopiperidin-1-ium-1-yl] methanesulfonate (PubChem CID 87279217) has the molecular formula C31H41N6O7S+ and a molecular weight of 641.77 g/mol. Its IUPAC name is [3-[6-[[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenyl]carbamoyl]-3-pyridinyl]-1,2,2,6,6-pentamethyl-4-oxopiperidin-1-ium-1-yl] methanesulfonate.
| Compound Name | [3-[6-[[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenyl]carbamoyl]-3-pyridinyl]-1,2,2,6,6-pentamethyl-4-oxopiperidin-1-ium-1-yl] methanesulfonate |
|---|---|
| PubChem CID | 87279217 |
| Molecular Formula | C31H41N6O7S+ |
| Molecular Weight | 641.77 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | [3-[6-[[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenyl]carbamoyl]-3-pyridinyl]-1,2,2,6,6-pentamethyl-4-oxopiperidin-1-ium-1-yl] methanesulfonate |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(NC(=O)c3ccc(C4C(=O)CC(C)(C)[N+](C)(OS(C)(=O)=O)C4(C)C)cn3)cc2)no1 |
| InChI | InChI=1S/C31H40N6O7S/c1-29(2,3)24-16-25(36-43-24)35-28(40)34-21-13-11-20(12-14-21)33-27(39)22-15-10-19(18-32-22)26-23(38)17-30(4,5)37(8,31(26,6)7)44-45(9,41)42/h10-16,18,26H,17H2,1-9H3,(H2-,32,33,34,35,36,39,40)/p+1 |
| InChIKey | QCAUZCFLKWJCTL-UHFFFAOYSA-O |
| XLogP | 5.21 |
| TPSA | 169.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.77 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|