C16H20F3NO7S — CID 87282650
methyl 3-(butoxycarbonylamino)-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate (PubChem CID 87282650) has the molecular formula C16H20F3NO7S and a molecular weight of 427.40 g/mol. Its IUPAC name is methyl 3-(butoxycarbonylamino)-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate.
| Compound Name | methyl 3-(butoxycarbonylamino)-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 87282650 |
| Molecular Formula | C16H20F3NO7S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | methyl 3-(butoxycarbonylamino)-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate |
| SMILES | CCCCOC(=O)NC(CC(=O)OC)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H20F3NO7S/c1-3-4-9-26-15(22)20-13(10-14(21)25-2)11-5-7-12(8-6-11)27-28(23,24)16(17,18)19/h5-8,13H,3-4,9-10H2,1-2H3,(H,20,22) |
| InChIKey | OCAWUIKSBVZARQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|