C16H19F2N5O2S2 — CID 87295144
N-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[(2S)-4-[(3,4-difluorophenyl)methyl]morpholin-2-yl]methyl]acetamide (PubChem CID 87295144) has the molecular formula C16H19F2N5O2S2 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[(2S)-4-[(3,4-difluorophenyl)methyl]morpholin-2-yl]methyl]acetamide.
| Compound Name | N-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[(2S)-4-[(3,4-difluorophenyl)methyl]morpholin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 87295144 |
| Molecular Formula | C16H19F2N5O2S2 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[(2S)-4-[(3,4-difluorophenyl)methyl]morpholin-2-yl]methyl]acetamide |
| SMILES | CC(=O)N(C[C@@H]1CN(Cc2ccc(F)c(F)c2)CCO1)Sc1nnc(N)s1 |
| InChI | InChI=1S/C16H19F2N5O2S2/c1-10(24)23(27-16-21-20-15(19)26-16)9-12-8-22(4-5-25-12)7-11-2-3-13(17)14(18)6-11/h2-3,6,12H,4-5,7-9H2,1H3,(H2,19,20)/t12-/m0/s1 |
| InChIKey | HOTLGSYNOKAJRO-LBPRGKRZSA-N |
| XLogP | 2.16 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|