C24H23Cl2N3O4S2 — CID 87294183
4-[2-[acetyl-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]amino]sulfanyl-1,3-thiazol-4-yl]benzoic acid (PubChem CID 87294183) has the molecular formula C24H23Cl2N3O4S2 and a molecular weight of 552.51 g/mol. Its IUPAC name is 4-[2-[acetyl-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]amino]sulfanyl-1,3-thiazol-4-yl]benzoic acid.
| Compound Name | 4-[2-[acetyl-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]amino]sulfanyl-1,3-thiazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 87294183 |
| Molecular Formula | C24H23Cl2N3O4S2 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 551.05 |
| IUPAC Name | 4-[2-[acetyl-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]amino]sulfanyl-1,3-thiazol-4-yl]benzoic acid |
| SMILES | CC(=O)N(C[C@@H]1CN(Cc2ccc(Cl)c(Cl)c2)CCO1)Sc1nc(-c2ccc(C(=O)O)cc2)cs1 |
| InChI | InChI=1S/C24H23Cl2N3O4S2/c1-15(30)29(35-24-27-22(14-34-24)17-3-5-18(6-4-17)23(31)32)13-19-12-28(8-9-33-19)11-16-2-7-20(25)21(26)10-16/h2-7,10,14,19H,8-9,11-13H2,1H3,(H,31,32)/t19-/m0/s1 |
| InChIKey | RVPCXVFDTMMBHC-IBGZPJMESA-N |
| XLogP | 5.57 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|