C21H23Cl2N3O3S — CID 87294676
3-[acetyl-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]amino]sulfanylbenzamide (PubChem CID 87294676) has the molecular formula C21H23Cl2N3O3S and a molecular weight of 468.41 g/mol. Its IUPAC name is 3-[acetyl-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]amino]sulfanylbenzamide.
| Compound Name | 3-[acetyl-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]amino]sulfanylbenzamide |
|---|---|
| PubChem CID | 87294676 |
| Molecular Formula | C21H23Cl2N3O3S |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 3-[acetyl-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]amino]sulfanylbenzamide |
| SMILES | CC(=O)N(C[C@@H]1CN(Cc2ccc(Cl)c(Cl)c2)CCO1)Sc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C21H23Cl2N3O3S/c1-14(27)26(30-18-4-2-3-16(10-18)21(24)28)13-17-12-25(7-8-29-17)11-15-5-6-19(22)20(23)9-15/h2-6,9-10,17H,7-8,11-13H2,1H3,(H2,24,28)/t17-/m0/s1 |
| InChIKey | ICMVAYMSXAZTRE-KRWDZBQOSA-N |
| XLogP | 3.85 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|