C20H22Cl2N4O3S — CID 87294833
6-[acetyl-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]amino]sulfanylpyridine-3-carboxamide (PubChem CID 87294833) has the molecular formula C20H22Cl2N4O3S and a molecular weight of 469.39 g/mol. Its IUPAC name is 6-[acetyl-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]amino]sulfanylpyridine-3-carboxamide.
| Compound Name | 6-[acetyl-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]amino]sulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 87294833 |
| Molecular Formula | C20H22Cl2N4O3S |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 6-[acetyl-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]amino]sulfanylpyridine-3-carboxamide |
| SMILES | CC(=O)N(C[C@@H]1CN(Cc2ccc(Cl)c(Cl)c2)CCO1)Sc1ccc(C(N)=O)cn1 |
| InChI | InChI=1S/C20H22Cl2N4O3S/c1-13(27)26(30-19-5-3-15(9-24-19)20(23)28)12-16-11-25(6-7-29-16)10-14-2-4-17(21)18(22)8-14/h2-5,8-9,16H,6-7,10-12H2,1H3,(H2,23,28)/t16-/m0/s1 |
| InChIKey | FSJDJGKIVGFKMT-INIZCTEOSA-N |
| XLogP | 3.24 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|