C30H26O4Ti — CID 87295952
bis(2,3-dimethoxy-1,9-dihydrofluoren-1-ide);titanium(2+) (PubChem CID 87295952) has the molecular formula C30H26O4Ti and a molecular weight of 498.40 g/mol. Its IUPAC name is bis(2,3-dimethoxy-1,9-dihydrofluoren-1-ide);titanium(2+).
| Compound Name | bis(2,3-dimethoxy-1,9-dihydrofluoren-1-ide);titanium(2+) |
|---|---|
| PubChem CID | 87295952 |
| Molecular Formula | C30H26O4Ti |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | bis(2,3-dimethoxy-1,9-dihydrofluoren-1-ide);titanium(2+) |
| SMILES | COc1[c-]c2c(cc1OC)-c1ccccc1C2.COc1[c-]c2c(cc1OC)-c1ccccc1C2.[Ti+2] |
| InChI | InChI=1S/2C15H13O2.Ti/c2*1-16-14-8-11-7-10-5-3-4-6-12(10)13(11)9-15(14)17-2;/h2*3-6,9H,7H2,1-2H3;/q2*-1;+2 |
| InChIKey | XAHAGSJPYIAUHK-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|