C27H27Zr — CID 151556902
2,3-dimethyl-1,9-dihydrofluoren-1-ide;bis(5-methylcyclopenta-1,3-diene);zirconium(3+) (PubChem CID 151556902) has the molecular formula C27H27Zr and a molecular weight of 442.74 g/mol. Its IUPAC name is 2,3-dimethyl-1,9-dihydrofluoren-1-ide;bis(5-methylcyclopenta-1,3-diene);zirconium(3+).
| Compound Name | 2,3-dimethyl-1,9-dihydrofluoren-1-ide;bis(5-methylcyclopenta-1,3-diene);zirconium(3+) |
|---|---|
| PubChem CID | 151556902 |
| Molecular Formula | C27H27Zr |
| Molecular Weight | 442.74 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 2,3-dimethyl-1,9-dihydrofluoren-1-ide;bis(5-methylcyclopenta-1,3-diene);zirconium(3+) |
| SMILES | C[c-]1cccc1.C[c-]1cccc1.Cc1[c-]c2c(cc1C)-c1ccccc1C2.[Zr+3] |
| InChI | InChI=1S/C15H13.2C6H7.Zr/c1-10-7-13-9-12-5-3-4-6-14(12)15(13)8-11(10)2;2*1-6-4-2-3-5-6;/h3-6,8H,9H2,1-2H3;2*2-5H,1H3;/q3*-1;+3 |
| InChIKey | PJEPHLVTDQRCQO-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.74 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|