C29H36F3N3O4 — CID 87302184
N-butanoyloxy-1-[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]-N-[[2-(trifluoromethyl)phenyl]methyl]methanamine oxide (PubChem CID 87302184) has the molecular formula C29H36F3N3O4 and a molecular weight of 547.62 g/mol. Its IUPAC name is N-butanoyloxy-1-[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]-N-[[2-(trifluoromethyl)phenyl]methyl]methanamine oxide.
| Compound Name | N-butanoyloxy-1-[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]-N-[[2-(trifluoromethyl)phenyl]methyl]methanamine oxide |
|---|---|
| PubChem CID | 87302184 |
| Molecular Formula | C29H36F3N3O4 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | N-butanoyloxy-1-[4-(3-octyl-1,2,4-oxadiazol-5-yl)phenyl]-N-[[2-(trifluoromethyl)phenyl]methyl]methanamine oxide |
| SMILES | CCCCCCCCc1noc(-c2ccc(C[N+]([O-])(Cc3ccccc3C(F)(F)F)OC(=O)CCC)cc2)n1 |
| InChI | InChI=1S/C29H36F3N3O4/c1-3-5-6-7-8-9-15-26-33-28(38-34-26)23-18-16-22(17-19-23)20-35(37,39-27(36)12-4-2)21-24-13-10-11-14-25(24)29(30,31)32/h10-11,13-14,16-19H,3-9,12,15,20-21H2,1-2H3 |
| InChIKey | KPCKMIYRDXXLMM-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|