C25H34N2O5 — CID 87302576
4-[(2Z)-2-[3-tert-butyl-4-(diethylamino)-5-ethylphenyl]-2-hydroxyiminoethoxy]-2-hydroxybenzoic acid (PubChem CID 87302576) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-[(2Z)-2-[3-tert-butyl-4-(diethylamino)-5-ethylphenyl]-2-hydroxyiminoethoxy]-2-hydroxybenzoic acid.
| Compound Name | 4-[(2Z)-2-[3-tert-butyl-4-(diethylamino)-5-ethylphenyl]-2-hydroxyiminoethoxy]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 87302576 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 4-[(2Z)-2-[3-tert-butyl-4-(diethylamino)-5-ethylphenyl]-2-hydroxyiminoethoxy]-2-hydroxybenzoic acid |
| SMILES | CCc1cc(/C(COc2ccc(C(=O)O)c(O)c2)=N/O)cc(C(C)(C)C)c1N(CC)CC |
| InChI | InChI=1S/C25H34N2O5/c1-7-16-12-17(13-20(25(4,5)6)23(16)27(8-2)9-3)21(26-31)15-32-18-10-11-19(24(29)30)22(28)14-18/h10-14,28,31H,7-9,15H2,1-6H3,(H,29,30)/b26-21+ |
| InChIKey | MBSCDEMHKGLWQA-YYADALCUSA-N |
| XLogP | 5.05 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|