C23H28N2O7 — CID 87302507
4-[2-[3-tert-butyl-4-[ethyl(methoxycarbonyl)amino]phenyl]-2-hydroxyiminoethoxy]-2-hydroxybenzoic acid (PubChem CID 87302507) has the molecular formula C23H28N2O7 and a molecular weight of 444.48 g/mol. Its IUPAC name is 4-[2-[3-tert-butyl-4-[ethyl(methoxycarbonyl)amino]phenyl]-2-hydroxyiminoethoxy]-2-hydroxybenzoic acid.
| Compound Name | 4-[2-[3-tert-butyl-4-[ethyl(methoxycarbonyl)amino]phenyl]-2-hydroxyiminoethoxy]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 87302507 |
| Molecular Formula | C23H28N2O7 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 4-[2-[3-tert-butyl-4-[ethyl(methoxycarbonyl)amino]phenyl]-2-hydroxyiminoethoxy]-2-hydroxybenzoic acid |
| SMILES | CCN(C(=O)OC)c1ccc(C(COc2ccc(C(=O)O)c(O)c2)=NO)cc1C(C)(C)C |
| InChI | InChI=1S/C23H28N2O7/c1-6-25(22(29)31-5)19-10-7-14(11-17(19)23(2,3)4)18(24-30)13-32-15-8-9-16(21(27)28)20(26)12-15/h7-12,26,30H,6,13H2,1-5H3,(H,27,28) |
| InChIKey | ZOLANHMCIMORGO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 128.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|