C40H74N2O8 — CID 87303661
2-[3-[(4S)-2-[bis(2-hydroxyethyl)amino]-1,3,4-trihydroxypentan-3-yl]-1-(dioctylamino)octoxy]benzoic acid (PubChem CID 87303661) has the molecular formula C40H74N2O8 and a molecular weight of 711.04 g/mol. Its IUPAC name is 2-[3-[(4S)-2-[bis(2-hydroxyethyl)amino]-1,3,4-trihydroxypentan-3-yl]-1-(dioctylamino)octoxy]benzoic acid.
| Compound Name | 2-[3-[(4S)-2-[bis(2-hydroxyethyl)amino]-1,3,4-trihydroxypentan-3-yl]-1-(dioctylamino)octoxy]benzoic acid |
|---|---|
| PubChem CID | 87303661 |
| Molecular Formula | C40H74N2O8 |
| Molecular Weight | 711.04 g/mol |
| Exact Mass | 710.54 |
| IUPAC Name | 2-[3-[(4S)-2-[bis(2-hydroxyethyl)amino]-1,3,4-trihydroxypentan-3-yl]-1-(dioctylamino)octoxy]benzoic acid |
| SMILES | CCCCCCCCN(CCCCCCCC)C(CC(CCCCC)C(O)(C(CO)N(CCO)CCO)[C@H](C)O)Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C40H74N2O8/c1-5-8-11-13-15-20-25-42(26-21-16-14-12-9-6-2)38(50-36-24-19-18-23-35(36)39(47)48)31-34(22-17-10-7-3)40(49,33(4)46)37(32-45)41(27-29-43)28-30-44/h18-19,23-24,33-34,37-38,43-46,49H,5-17,20-22,25-32H2,1-4H3,(H,47,48)/t33-,34?,37?,38?,40?/m0/s1 |
| InChIKey | VNDUDAUZRBWUDV-HRQOAFBRSA-N |
| XLogP | 6.46 |
| TPSA | 154.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.04 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|