C10H13F8NO2S — CID 87304829
(2S)-4-methylsulfanyl-2-(1,1,2,2,3,3,4,4-octafluoropentylamino)butanoic acid (PubChem CID 87304829) has the molecular formula C10H13F8NO2S and a molecular weight of 363.27 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-(1,1,2,2,3,3,4,4-octafluoropentylamino)butanoic acid.
| Compound Name | (2S)-4-methylsulfanyl-2-(1,1,2,2,3,3,4,4-octafluoropentylamino)butanoic acid |
|---|---|
| PubChem CID | 87304829 |
| Molecular Formula | C10H13F8NO2S |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-(1,1,2,2,3,3,4,4-octafluoropentylamino)butanoic acid |
| SMILES | CSCC[C@H](NC(F)(F)C(F)(F)C(F)(F)C(C)(F)F)C(=O)O |
| InChI | InChI=1S/C10H13F8NO2S/c1-7(11,12)8(13,14)9(15,16)10(17,18)19-5(6(20)21)3-4-22-2/h5,19H,3-4H2,1-2H3,(H,20,21)/t5-/m0/s1 |
| InChIKey | ICTQKBPCQNEQDU-YFKPBYRVSA-N |
| XLogP | 3.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|