C25H21FN4O5 — CID 87305785
N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoylamino]-N-(3-fluorophenyl)formamide (PubChem CID 87305785) has the molecular formula C25H21FN4O5 and a molecular weight of 476.46 g/mol. Its IUPAC name is N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoylamino]-N-(3-fluorophenyl)formamide.
| Compound Name | N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoylamino]-N-(3-fluorophenyl)formamide |
|---|---|
| PubChem CID | 87305785 |
| Molecular Formula | C25H21FN4O5 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoylamino]-N-(3-fluorophenyl)formamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)NN(C=O)c4cccc(F)c4)cc3)c2cc1OC |
| InChI | InChI=1S/C25H21FN4O5/c1-33-23-13-20-21(14-24(23)34-2)27-11-10-22(20)35-19-8-6-17(7-9-19)28-25(32)29-30(15-31)18-5-3-4-16(26)12-18/h3-15H,1-2H3,(H2,28,29,32) |
| InChIKey | PABLIOITYJEDSX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|