C35H28AsClN5O3 — CID 87305811
CID 87305811 (PubChem CID 87305811) has the molecular formula C35H28AsClN5O3 and a molecular weight of 677.02 g/mol.
| Compound Name | CID 87305811 |
|---|---|
| PubChem CID | 87305811 |
| Molecular Formula | C35H28AsClN5O3 |
| Molecular Weight | 677.02 g/mol |
| Exact Mass | 676.11 |
| IUPAC Name | — |
| SMILES | O=C(Nc1cccc(-c2nc3ccccn3c2-c2ccnc([As]c3cccc(OCC4CCCO4)c3)n2)c1)c1ccccc1Cl |
| InChI | InChI=1S/C35H28AsClN5O3/c37-29-14-2-1-13-28(29)34(43)39-25-10-5-8-23(20-25)32-33(42-18-4-3-15-31(42)41-32)30-16-17-38-35(40-30)36-24-9-6-11-26(21-24)45-22-27-12-7-19-44-27/h1-6,8-11,13-18,20-21,27H,7,12,19,22H2,(H,39,43) |
| InChIKey | XILXDKQYQQPSBW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.02 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|