C7H2BrF9 — CID 87309178
(4E)-4-bromo-1,1,1,6,6,6-hexafluoro-2-(trifluoromethyl)hexa-2,4-diene (PubChem CID 87309178) has the molecular formula C7H2BrF9 and a molecular weight of 336.98 g/mol. Its IUPAC name is (4E)-4-bromo-1,1,1,6,6,6-hexafluoro-2-(trifluoromethyl)hexa-2,4-diene.
| Compound Name | (4E)-4-bromo-1,1,1,6,6,6-hexafluoro-2-(trifluoromethyl)hexa-2,4-diene |
|---|---|
| PubChem CID | 87309178 |
| Molecular Formula | C7H2BrF9 |
| Molecular Weight | 336.98 g/mol |
| Exact Mass | 335.92 |
| IUPAC Name | (4E)-4-bromo-1,1,1,6,6,6-hexafluoro-2-(trifluoromethyl)hexa-2,4-diene |
| SMILES | FC(F)(F)/C=C(/Br)C=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H2BrF9/c8-3(2-5(9,10)11)1-4(6(12,13)14)7(15,16)17/h1-2H/b3-2+ |
| InChIKey | OSKFEUDCYCHEOP-NSCUHMNNSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.98 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|