C19H19N5O2S — CID 87310904
(5E)-5-[[2-[(5-phenylpiperidin-3-yl)amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87310904) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is (5E)-5-[[2-[(5-phenylpiperidin-3-yl)amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-[(5-phenylpiperidin-3-yl)amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87310904 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (5E)-5-[[2-[(5-phenylpiperidin-3-yl)amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccnc(NC3CNCC(c4ccccc4)C3)n2)S1 |
| InChI | InChI=1S/C19H19N5O2S/c25-17-16(27-19(26)24-17)9-14-6-7-21-18(22-14)23-15-8-13(10-20-11-15)12-4-2-1-3-5-12/h1-7,9,13,15,20H,8,10-11H2,(H,21,22,23)(H,24,25,26)/b16-9+ |
| InChIKey | IRXSKKRWXNNRLS-CXUHLZMHSA-N |
| XLogP | 2.36 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|