C10H17N3O5 — CID 87312586
(2-methylpropan-2-yl)oxycarbonyl 2-amino-3-oxopiperazine-1-carboxylate (PubChem CID 87312586) has the molecular formula C10H17N3O5 and a molecular weight of 259.26 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxycarbonyl 2-amino-3-oxopiperazine-1-carboxylate.
| Compound Name | (2-methylpropan-2-yl)oxycarbonyl 2-amino-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 87312586 |
| Molecular Formula | C10H17N3O5 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (2-methylpropan-2-yl)oxycarbonyl 2-amino-3-oxopiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)OC(=O)N1CCNC(=O)C1N |
| InChI | InChI=1S/C10H17N3O5/c1-10(2,3)18-9(16)17-8(15)13-5-4-12-7(14)6(13)11/h6H,4-5,11H2,1-3H3,(H,12,14) |
| InChIKey | CKELAJWKTKMSFF-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|